C17H22BNO3S — CID 170803290
7-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-dihydroindol-2-one (PubChem CID 170803290) has the molecular formula C17H22BNO3S and a molecular weight of 331.25 g/mol. Its IUPAC name is 7-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-dihydroindol-2-one.
| Compound Name | 7-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 170803290 |
| Molecular Formula | C17H22BNO3S |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 7-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-dihydroindol-2-one |
| SMILES | CC1(C)OB(C(=Cc2cccc3c2NC(=O)C3)CS)OC1(C)C |
| InChI | InChI=1S/C17H22BNO3S/c1-16(2)17(3,4)22-18(21-16)13(10-23)8-11-6-5-7-12-9-14(20)19-15(11)12/h5-8,23H,9-10H2,1-4H3,(H,19,20) |
| InChIKey | SOHHDDPHEXBUQU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|