C16H22BNO4S — CID 170803484
2-amino-3-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid (PubChem CID 170803484) has the molecular formula C16H22BNO4S and a molecular weight of 335.23 g/mol. Its IUPAC name is 2-amino-3-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid.
| Compound Name | 2-amino-3-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 170803484 |
| Molecular Formula | C16H22BNO4S |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-amino-3-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid |
| SMILES | CC1(C)OB(C(=Cc2cccc(C(=O)O)c2N)CS)OC1(C)C |
| InChI | InChI=1S/C16H22BNO4S/c1-15(2)16(3,4)22-17(21-15)11(9-23)8-10-6-5-7-12(13(10)18)14(19)20/h5-8,23H,9,18H2,1-4H3,(H,19,20) |
| InChIKey | MYCJMILKEURYHF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|