C15H22BFN2O2S — CID 170803034
3-(2,3-diamino-5-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol (PubChem CID 170803034) has the molecular formula C15H22BFN2O2S and a molecular weight of 324.23 g/mol. Its IUPAC name is 3-(2,3-diamino-5-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol.
| Compound Name | 3-(2,3-diamino-5-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170803034 |
| Molecular Formula | C15H22BFN2O2S |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 3-(2,3-diamino-5-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
| SMILES | CC1(C)OB(C(=Cc2cc(F)cc(N)c2N)CS)OC1(C)C |
| InChI | InChI=1S/C15H22BFN2O2S/c1-14(2)15(3,4)21-16(20-14)10(8-22)5-9-6-11(17)7-12(18)13(9)19/h5-7,22H,8,18-19H2,1-4H3 |
| InChIKey | FEZYYZMOYGECCL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|