C15H19BClFO2S — CID 170802640
3-(5-chloro-2-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol (PubChem CID 170802640) has the molecular formula C15H19BClFO2S and a molecular weight of 328.65 g/mol. Its IUPAC name is 3-(5-chloro-2-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol.
| Compound Name | 3-(5-chloro-2-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170802640 |
| Molecular Formula | C15H19BClFO2S |
| Molecular Weight | 328.65 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 3-(5-chloro-2-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
| SMILES | CC1(C)OB(C(=Cc2cc(Cl)ccc2F)CS)OC1(C)C |
| InChI | InChI=1S/C15H19BClFO2S/c1-14(2)15(3,4)20-16(19-14)11(9-21)7-10-8-12(17)5-6-13(10)18/h5-8,21H,9H2,1-4H3 |
| InChIKey | XFANHMXCSUJZFI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.65 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|