C16H19BF4O2S — CID 170803536
3-[3-fluoro-4-(trifluoromethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol (PubChem CID 170803536) has the molecular formula C16H19BF4O2S and a molecular weight of 362.20 g/mol. Its IUPAC name is 3-[3-fluoro-4-(trifluoromethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol.
| Compound Name | 3-[3-fluoro-4-(trifluoromethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170803536 |
| Molecular Formula | C16H19BF4O2S |
| Molecular Weight | 362.20 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 3-[3-fluoro-4-(trifluoromethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
| SMILES | CC1(C)OB(C(=Cc2ccc(C(F)(F)F)c(F)c2)CS)OC1(C)C |
| InChI | InChI=1S/C16H19BF4O2S/c1-14(2)15(3,4)23-17(22-14)11(9-24)7-10-5-6-12(13(18)8-10)16(19,20)21/h5-8,24H,9H2,1-4H3 |
| InChIKey | WMEPSYUVIGQEKZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.20 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|