C17H19BF3NO2S — CID 170803853
4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3-(trifluoromethyl)benzonitrile (PubChem CID 170803853) has the molecular formula C17H19BF3NO2S and a molecular weight of 369.22 g/mol. Its IUPAC name is 4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 170803853 |
| Molecular Formula | C17H19BF3NO2S |
| Molecular Weight | 369.22 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3-(trifluoromethyl)benzonitrile |
| SMILES | CC1(C)OB(C(=Cc2ccc(C#N)cc2C(F)(F)F)CS)OC1(C)C |
| InChI | InChI=1S/C17H19BF3NO2S/c1-15(2)16(3,4)24-18(23-15)13(10-25)8-12-6-5-11(9-22)7-14(12)17(19,20)21/h5-8,25H,10H2,1-4H3 |
| InChIKey | HASWYJGUOYKANJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 42.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.22 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|