C17H22BNO2S — CID 170804041
2-[2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetonitrile (PubChem CID 170804041) has the molecular formula C17H22BNO2S and a molecular weight of 315.25 g/mol. Its IUPAC name is 2-[2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetonitrile.
| Compound Name | 2-[2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetonitrile |
|---|---|
| PubChem CID | 170804041 |
| Molecular Formula | C17H22BNO2S |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 2-[2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetonitrile |
| SMILES | CC1(C)OB(C(=Cc2ccccc2CC#N)CS)OC1(C)C |
| InChI | InChI=1S/C17H22BNO2S/c1-16(2)17(3,4)21-18(20-16)15(12-22)11-14-8-6-5-7-13(14)9-10-19/h5-8,11,22H,9,12H2,1-4H3 |
| InChIKey | CLPZJIUSVLFEMA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 42.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|