C17H21BBrNO2S — CID 170804057
4-(bromomethyl)-3-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzonitrile (PubChem CID 170804057) has the molecular formula C17H21BBrNO2S and a molecular weight of 394.14 g/mol. Its IUPAC name is 4-(bromomethyl)-3-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzonitrile.
| Compound Name | 4-(bromomethyl)-3-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 170804057 |
| Molecular Formula | C17H21BBrNO2S |
| Molecular Weight | 394.14 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 4-(bromomethyl)-3-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzonitrile |
| SMILES | CC1(C)OB(C(=Cc2cc(C#N)ccc2CBr)CS)OC1(C)C |
| InChI | InChI=1S/C17H21BBrNO2S/c1-16(2)17(3,4)22-18(21-16)15(11-23)8-14-7-12(10-20)5-6-13(14)9-19/h5-8,23H,9,11H2,1-4H3 |
| InChIKey | POVBUBREPBEPRI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 42.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.14 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|