C15H18BBrF2O2S — CID 170804034
3-(4-bromo-3,5-difluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol (PubChem CID 170804034) has the molecular formula C15H18BBrF2O2S and a molecular weight of 391.09 g/mol. Its IUPAC name is 3-(4-bromo-3,5-difluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol.
| Compound Name | 3-(4-bromo-3,5-difluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170804034 |
| Molecular Formula | C15H18BBrF2O2S |
| Molecular Weight | 391.09 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 3-(4-bromo-3,5-difluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
| SMILES | CC1(C)OB(C(=Cc2cc(F)c(Br)c(F)c2)CS)OC1(C)C |
| InChI | InChI=1S/C15H18BBrF2O2S/c1-14(2)15(3,4)21-16(20-14)10(8-22)5-9-6-11(18)13(17)12(19)7-9/h5-7,22H,8H2,1-4H3 |
| InChIKey | FZVZKFAVYSFXAZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.09 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|