C15H19BBrClO2S — CID 170804002
3-(3-bromo-5-chlorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol (PubChem CID 170804002) has the molecular formula C15H19BBrClO2S and a molecular weight of 389.55 g/mol. Its IUPAC name is 3-(3-bromo-5-chlorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol.
| Compound Name | 3-(3-bromo-5-chlorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170804002 |
| Molecular Formula | C15H19BBrClO2S |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 3-(3-bromo-5-chlorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
| SMILES | CC1(C)OB(C(=Cc2cc(Cl)cc(Br)c2)CS)OC1(C)C |
| InChI | InChI=1S/C15H19BBrClO2S/c1-14(2)15(3,4)20-16(19-14)11(9-21)5-10-6-12(17)8-13(18)7-10/h5-8,21H,9H2,1-4H3 |
| InChIKey | NFXZEGYBZBDHEL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|