C18H27BO2S — CID 170802907
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,6-trimethylphenyl)prop-2-ene-1-thiol (PubChem CID 170802907) has the molecular formula C18H27BO2S and a molecular weight of 318.29 g/mol. Its IUPAC name is 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,6-trimethylphenyl)prop-2-ene-1-thiol.
| Compound Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,6-trimethylphenyl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170802907 |
| Molecular Formula | C18H27BO2S |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,6-trimethylphenyl)prop-2-ene-1-thiol |
| SMILES | Cc1cc(C)c(C=C(CS)B2OC(C)(C)C(C)(C)O2)c(C)c1 |
| InChI | InChI=1S/C18H27BO2S/c1-12-8-13(2)16(14(3)9-12)10-15(11-22)19-20-17(4,5)18(6,7)21-19/h8-10,22H,11H2,1-7H3 |
| InChIKey | ZAPSWHYDQJCKNO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|