C23H36BNO4 — CID 170809423
tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,6-trimethylphenyl)prop-2-enyl]carbamate (PubChem CID 170809423) has the molecular formula C23H36BNO4 and a molecular weight of 401.36 g/mol. Its IUPAC name is tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,6-trimethylphenyl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,6-trimethylphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809423 |
| Molecular Formula | C23H36BNO4 |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,6-trimethylphenyl)prop-2-enyl]carbamate |
| SMILES | Cc1cc(C)c(C=C(CNC(=O)OC(C)(C)C)B2OC(C)(C)C(C)(C)O2)c(C)c1 |
| InChI | InChI=1S/C23H36BNO4/c1-15-11-16(2)19(17(3)12-15)13-18(14-25-20(26)27-21(4,5)6)24-28-22(7,8)23(9,10)29-24/h11-13H,14H2,1-10H3,(H,25,26) |
| InChIKey | QYORMAJKGUBUEQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|