C20H28BF2NO5 — CID 170809542
tert-butyl N-[3-(2,6-difluoro-4-hydroxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809542) has the molecular formula C20H28BF2NO5 and a molecular weight of 411.25 g/mol. Its IUPAC name is tert-butyl N-[3-(2,6-difluoro-4-hydroxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(2,6-difluoro-4-hydroxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809542 |
| Molecular Formula | C20H28BF2NO5 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | tert-butyl N-[3-(2,6-difluoro-4-hydroxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1c(F)cc(O)cc1F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H28BF2NO5/c1-18(2,3)27-17(26)24-11-12(21-28-19(4,5)20(6,7)29-21)8-14-15(22)9-13(25)10-16(14)23/h8-10,25H,11H2,1-7H3,(H,24,26) |
| InChIKey | MKHBFCPMKBBJTE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|