C21H29BFNO5 — CID 170809471
tert-butyl N-[3-(4-fluoro-2-formylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809471) has the molecular formula C21H29BFNO5 and a molecular weight of 405.28 g/mol. Its IUPAC name is tert-butyl N-[3-(4-fluoro-2-formylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-fluoro-2-formylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809471 |
| Molecular Formula | C21H29BFNO5 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | tert-butyl N-[3-(4-fluoro-2-formylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1ccc(F)cc1C=O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H29BFNO5/c1-19(2,3)27-18(26)24-12-16(22-28-20(4,5)21(6,7)29-22)10-14-8-9-17(23)11-15(14)13-25/h8-11,13H,12H2,1-7H3,(H,24,26) |
| InChIKey | NZXDDQMFSQTWQJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|