C22H34BNO4 — CID 170809143
tert-butyl N-[3-(2,5-dimethylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809143) has the molecular formula C22H34BNO4 and a molecular weight of 387.33 g/mol. Its IUPAC name is tert-butyl N-[3-(2,5-dimethylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(2,5-dimethylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809143 |
| Molecular Formula | C22H34BNO4 |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | tert-butyl N-[3-(2,5-dimethylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | Cc1ccc(C)c(C=C(CNC(=O)OC(C)(C)C)B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C22H34BNO4/c1-15-10-11-16(2)17(12-15)13-18(14-24-19(25)26-20(3,4)5)23-27-21(6,7)22(8,9)28-23/h10-13H,14H2,1-9H3,(H,24,25) |
| InChIKey | HZPLLMAIFJJCTD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|