C22H33BClNO4 — CID 170809414
tert-butyl N-[3-(4-chloro-2,6-dimethylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809414) has the molecular formula C22H33BClNO4 and a molecular weight of 421.77 g/mol. Its IUPAC name is tert-butyl N-[3-(4-chloro-2,6-dimethylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-chloro-2,6-dimethylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809414 |
| Molecular Formula | C22H33BClNO4 |
| Molecular Weight | 421.77 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | tert-butyl N-[3-(4-chloro-2,6-dimethylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | Cc1cc(Cl)cc(C)c1C=C(CNC(=O)OC(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H33BClNO4/c1-14-10-17(24)11-15(2)18(14)12-16(13-25-19(26)27-20(3,4)5)23-28-21(6,7)22(8,9)29-23/h10-12H,13H2,1-9H3,(H,25,26) |
| InChIKey | FCYFZYDUDZOUCP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.77 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|