C20H27BCl3NO4 — CID 170809398
tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,3,5-trichlorophenyl)prop-2-enyl]carbamate (PubChem CID 170809398) has the molecular formula C20H27BCl3NO4 and a molecular weight of 462.61 g/mol. Its IUPAC name is tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,3,5-trichlorophenyl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,3,5-trichlorophenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809398 |
| Molecular Formula | C20H27BCl3NO4 |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,3,5-trichlorophenyl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1cc(Cl)cc(Cl)c1Cl)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H27BCl3NO4/c1-18(2,3)27-17(26)25-11-13(21-28-19(4,5)20(6,7)29-21)8-12-9-14(22)10-15(23)16(12)24/h8-10H,11H2,1-7H3,(H,25,26) |
| InChIKey | BCQBYGBUJAAJRN-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|