C20H30BClN2O5 — CID 170809680
tert-butyl N-[3-(5-chloro-2-methoxy-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809680) has the molecular formula C20H30BClN2O5 and a molecular weight of 424.73 g/mol. Its IUPAC name is tert-butyl N-[3-(5-chloro-2-methoxy-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(5-chloro-2-methoxy-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809680 |
| Molecular Formula | C20H30BClN2O5 |
| Molecular Weight | 424.73 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | tert-butyl N-[3-(5-chloro-2-methoxy-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | COc1ncc(Cl)cc1C=C(CNC(=O)OC(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H30BClN2O5/c1-18(2,3)27-17(25)24-11-14(21-28-19(4,5)20(6,7)29-21)9-13-10-15(22)12-23-16(13)26-8/h9-10,12H,11H2,1-8H3,(H,24,25) |
| InChIKey | PGMZTFQMRYKNKV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.73 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|