C23H34BNO7 — CID 170810357
tert-butyl N-[3-(4-formyl-2,5-dimethoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810357) has the molecular formula C23H34BNO7 and a molecular weight of 447.34 g/mol. Its IUPAC name is tert-butyl N-[3-(4-formyl-2,5-dimethoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-formyl-2,5-dimethoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810357 |
| Molecular Formula | C23H34BNO7 |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | tert-butyl N-[3-(4-formyl-2,5-dimethoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | COc1cc(C=C(CNC(=O)OC(C)(C)C)B2OC(C)(C)C(C)(C)O2)c(OC)cc1C=O |
| InChI | InChI=1S/C23H34BNO7/c1-21(2,3)30-20(27)25-13-17(24-31-22(4,5)23(6,7)32-24)10-15-11-19(29-9)16(14-26)12-18(15)28-8/h10-12,14H,13H2,1-9H3,(H,25,27) |
| InChIKey | SVRKFPCETMKMMN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|