C19H28BNO5 — CID 170815244
2,5-dimethoxy-4-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzaldehyde (PubChem CID 170815244) has the molecular formula C19H28BNO5 and a molecular weight of 361.25 g/mol. Its IUPAC name is 2,5-dimethoxy-4-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzaldehyde.
| Compound Name | 2,5-dimethoxy-4-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzaldehyde |
|---|---|
| PubChem CID | 170815244 |
| Molecular Formula | C19H28BNO5 |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 2,5-dimethoxy-4-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzaldehyde |
| SMILES | CNCC(=Cc1cc(OC)c(C=O)cc1OC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H28BNO5/c1-18(2)19(3,4)26-20(25-18)15(11-21-5)8-13-9-17(24-7)14(12-22)10-16(13)23-6/h8-10,12,21H,11H2,1-7H3 |
| InChIKey | PSWCGKZLVSJUOE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|