C18H26BNO5 — CID 170815009
4-hydroxy-5-methoxy-2-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzaldehyde (PubChem CID 170815009) has the molecular formula C18H26BNO5 and a molecular weight of 347.22 g/mol. Its IUPAC name is 4-hydroxy-5-methoxy-2-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzaldehyde.
| Compound Name | 4-hydroxy-5-methoxy-2-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzaldehyde |
|---|---|
| PubChem CID | 170815009 |
| Molecular Formula | C18H26BNO5 |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 4-hydroxy-5-methoxy-2-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzaldehyde |
| SMILES | CNCC(=Cc1cc(O)c(OC)cc1C=O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H26BNO5/c1-17(2)18(3,4)25-19(24-17)14(10-20-5)7-12-8-15(22)16(23-6)9-13(12)11-21/h7-9,11,20,22H,10H2,1-6H3 |
| InChIKey | YQABMPKSPVTGJZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|