C16H23BFNO3 — CID 170814077
5-fluoro-2-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenol (PubChem CID 170814077) has the molecular formula C16H23BFNO3 and a molecular weight of 307.17 g/mol. Its IUPAC name is 5-fluoro-2-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenol.
| Compound Name | 5-fluoro-2-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenol |
|---|---|
| PubChem CID | 170814077 |
| Molecular Formula | C16H23BFNO3 |
| Molecular Weight | 307.17 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 5-fluoro-2-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenol |
| SMILES | CNCC(=Cc1ccc(F)cc1O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H23BFNO3/c1-15(2)16(3,4)22-17(21-15)12(10-19-5)8-11-6-7-13(18)9-14(11)20/h6-9,19-20H,10H2,1-5H3 |
| InChIKey | VKRHPVDXBNOOKJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.17 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|