C16H24BNO4 — CID 170814065
4-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzene-1,2-diol (PubChem CID 170814065) has the molecular formula C16H24BNO4 and a molecular weight of 305.18 g/mol. Its IUPAC name is 4-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzene-1,2-diol.
| Compound Name | 4-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 170814065 |
| Molecular Formula | C16H24BNO4 |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 4-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzene-1,2-diol |
| SMILES | CNCC(=Cc1ccc(O)c(O)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H24BNO4/c1-15(2)16(3,4)22-17(21-15)12(10-18-5)8-11-6-7-13(19)14(20)9-11/h6-9,18-20H,10H2,1-5H3 |
| InChIKey | NYTGYHPPXYFUFV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|