C18H23BN2O4 — CID 170815138
5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2,3-dione (PubChem CID 170815138) has the molecular formula C18H23BN2O4 and a molecular weight of 342.20 g/mol. Its IUPAC name is 5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2,3-dione.
| Compound Name | 5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 170815138 |
| Molecular Formula | C18H23BN2O4 |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2,3-dione |
| SMILES | CNCC(=Cc1ccc2c(c1)C(=O)C(=O)N2)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H23BN2O4/c1-17(2)18(3,4)25-19(24-17)12(10-20-5)8-11-6-7-14-13(9-11)15(22)16(23)21-14/h6-9,20H,10H2,1-5H3,(H,21,22,23) |
| InChIKey | FEFCCDDPGMJCBO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|