C18H24BN3O3 — CID 170815121
6-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3H-quinazolin-4-one (PubChem CID 170815121) has the molecular formula C18H24BN3O3 and a molecular weight of 341.22 g/mol. Its IUPAC name is 6-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3H-quinazolin-4-one.
| Compound Name | 6-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 170815121 |
| Molecular Formula | C18H24BN3O3 |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 6-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3H-quinazolin-4-one |
| SMILES | CNCC(=Cc1ccc2nc[nH]c(=O)c2c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H24BN3O3/c1-17(2)18(3,4)25-19(24-17)13(10-20-5)8-12-6-7-15-14(9-12)16(23)22-11-21-15/h6-9,11,20H,10H2,1-5H3,(H,21,22,23) |
| InChIKey | BTPWMSOHJIOWQG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|