C15H22BN5O2 — CID 170814614
N-methyl-3-(7H-purin-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 170814614) has the molecular formula C15H22BN5O2 and a molecular weight of 315.19 g/mol. Its IUPAC name is N-methyl-3-(7H-purin-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | N-methyl-3-(7H-purin-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 170814614 |
| Molecular Formula | C15H22BN5O2 |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | N-methyl-3-(7H-purin-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | CNCC(=Cc1ncnc2nc[nH]c12)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H22BN5O2/c1-14(2)15(3,4)23-16(22-14)10(7-17-5)6-11-12-13(20-8-18-11)21-9-19-12/h6,8-9,17H,7H2,1-5H3,(H,18,19,20,21) |
| InChIKey | AZWJFOMQUYIYBC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|