C15H22BN5O3 — CID 170814658
3-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 170814658) has the molecular formula C15H22BN5O3 and a molecular weight of 331.19 g/mol. Its IUPAC name is 3-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 3-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 170814658 |
| Molecular Formula | C15H22BN5O3 |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 3-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | CNCC(=Cc1[nH]nc2nc[nH]c(=O)c12)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H22BN5O3/c1-14(2)15(3,4)24-16(23-14)9(7-17-5)6-10-11-12(21-20-10)18-8-19-13(11)22/h6,8,17H,7H2,1-5H3,(H2,18,19,20,21,22) |
| InChIKey | PITXBNJREILOGN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|