C18H28BNO2 — CID 170814031
3-(2,6-dimethylphenyl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 170814031) has the molecular formula C18H28BNO2 and a molecular weight of 301.24 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | 3-(2,6-dimethylphenyl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 170814031 |
| Molecular Formula | C18H28BNO2 |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | CNCC(=Cc1c(C)cccc1C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H28BNO2/c1-13-9-8-10-14(2)16(13)11-15(12-20-7)19-21-17(3,4)18(5,6)22-19/h8-11,20H,12H2,1-7H3 |
| InChIKey | GFIOKWWHJQCBCW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|