C16H21BBr2FNO2 — CID 170815436
3-(2,6-dibromo-4-fluorophenyl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 170815436) has the molecular formula C16H21BBr2FNO2 and a molecular weight of 448.97 g/mol. Its IUPAC name is 3-(2,6-dibromo-4-fluorophenyl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | 3-(2,6-dibromo-4-fluorophenyl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 170815436 |
| Molecular Formula | C16H21BBr2FNO2 |
| Molecular Weight | 448.97 g/mol |
| Exact Mass | 447.00 |
| IUPAC Name | 3-(2,6-dibromo-4-fluorophenyl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | CNCC(=Cc1c(Br)cc(F)cc1Br)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H21BBr2FNO2/c1-15(2)16(3,4)23-17(22-15)10(9-21-5)6-12-13(18)7-11(20)8-14(12)19/h6-8,21H,9H2,1-5H3 |
| InChIKey | DRQDIPHCHGLKDQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.97 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|