C18H26BNO2 — CID 170814027
3-(2-ethenylphenyl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 170814027) has the molecular formula C18H26BNO2 and a molecular weight of 299.22 g/mol. Its IUPAC name is 3-(2-ethenylphenyl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | 3-(2-ethenylphenyl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 170814027 |
| Molecular Formula | C18H26BNO2 |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 3-(2-ethenylphenyl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | C=Cc1ccccc1C=C(CNC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H26BNO2/c1-7-14-10-8-9-11-15(14)12-16(13-20-6)19-21-17(2,3)18(4,5)22-19/h7-12,20H,1,13H2,2-6H3 |
| InChIKey | PJYPYEBSGOBQBP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|