C16H27BN4O2 — CID 170814597
6-methyl-5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-2,3-diamine (PubChem CID 170814597) has the molecular formula C16H27BN4O2 and a molecular weight of 318.23 g/mol. Its IUPAC name is 6-methyl-5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-2,3-diamine.
| Compound Name | 6-methyl-5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 170814597 |
| Molecular Formula | C16H27BN4O2 |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 6-methyl-5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-2,3-diamine |
| SMILES | CNCC(=Cc1cc(N)c(N)nc1C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H27BN4O2/c1-10-11(8-13(18)14(19)21-10)7-12(9-20-6)17-22-15(2,3)16(4,5)23-17/h7-8,20H,9,18H2,1-6H3,(H2,19,21) |
| InChIKey | BISORSOMQUCMJR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|