C15H22BF3N4O2 — CID 170815080
5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 170815080) has the molecular formula C15H22BF3N4O2 and a molecular weight of 358.17 g/mol. Its IUPAC name is 5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 170815080 |
| Molecular Formula | C15H22BF3N4O2 |
| Molecular Weight | 358.17 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CNCC(=Cc1cnc(N)nc1C(F)(F)F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H22BF3N4O2/c1-13(2)14(3,4)25-16(24-13)10(8-21-5)6-9-7-22-12(20)23-11(9)15(17,18)19/h6-7,21H,8H2,1-5H3,(H2,20,22,23) |
| InChIKey | VHQHPELYDCZNAP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|