C15H24BN3O2 — CID 170813926
5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridin-2-amine (PubChem CID 170813926) has the molecular formula C15H24BN3O2 and a molecular weight of 289.19 g/mol. Its IUPAC name is 5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridin-2-amine.
| Compound Name | 5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridin-2-amine |
|---|---|
| PubChem CID | 170813926 |
| Molecular Formula | C15H24BN3O2 |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridin-2-amine |
| SMILES | CNCC(=Cc1ccc(N)nc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H24BN3O2/c1-14(2)15(3,4)21-16(20-14)12(10-18-5)8-11-6-7-13(17)19-9-11/h6-9,18H,10H2,1-5H3,(H2,17,19) |
| InChIKey | LTWSGLMWCORRJS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|