C17H23BN2O2S — CID 170814627
3-(1,3-benzothiazol-5-yl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 170814627) has the molecular formula C17H23BN2O2S and a molecular weight of 330.26 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-5-yl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | 3-(1,3-benzothiazol-5-yl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 170814627 |
| Molecular Formula | C17H23BN2O2S |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 3-(1,3-benzothiazol-5-yl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | CNCC(=Cc1ccc2scnc2c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H23BN2O2S/c1-16(2)17(3,4)22-18(21-16)13(10-19-5)8-12-6-7-15-14(9-12)20-11-23-15/h6-9,11,19H,10H2,1-5H3 |
| InChIKey | BOYIBVFFOUVXKC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|