C14H23BN2O3S — CID 170813977
[2-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazol-4-yl]methanol (PubChem CID 170813977) has the molecular formula C14H23BN2O3S and a molecular weight of 310.23 g/mol. Its IUPAC name is [2-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazol-4-yl]methanol.
| Compound Name | [2-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazol-4-yl]methanol |
|---|---|
| PubChem CID | 170813977 |
| Molecular Formula | C14H23BN2O3S |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [2-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazol-4-yl]methanol |
| SMILES | CNCC(=Cc1nc(CO)cs1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H23BN2O3S/c1-13(2)14(3,4)20-15(19-13)10(7-16-5)6-12-17-11(8-18)9-21-12/h6,9,16,18H,7-8H2,1-5H3 |
| InChIKey | KCKMBGDLVFIHBF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|