C21H27BN2O5S — CID 170812348
benzyl N-[3-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170812348) has the molecular formula C21H27BN2O5S and a molecular weight of 430.34 g/mol. Its IUPAC name is benzyl N-[3-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170812348 |
| Molecular Formula | C21H27BN2O5S |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | benzyl N-[3-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2nc(CO)cs2)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C21H27BN2O5S/c1-20(2)21(3,4)29-22(28-20)16(10-18-24-17(12-25)14-30-18)11-23-19(26)27-13-15-8-6-5-7-9-15/h5-10,14,25H,11-13H2,1-4H3,(H,23,26) |
| InChIKey | IBOUWIXAZZLDGV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|