C23H29BN2O6S — CID 170813247
ethyl 2-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-5-carboxylate (PubChem CID 170813247) has the molecular formula C23H29BN2O6S and a molecular weight of 472.37 g/mol. Its IUPAC name is ethyl 2-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 170813247 |
| Molecular Formula | C23H29BN2O6S |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | ethyl 2-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(C=C(CNC(=O)OCc2ccccc2)B2OC(C)(C)C(C)(C)O2)s1 |
| InChI | InChI=1S/C23H29BN2O6S/c1-6-29-20(27)18-14-25-19(33-18)12-17(24-31-22(2,3)23(4,5)32-24)13-26-21(28)30-15-16-10-8-7-9-11-16/h7-12,14H,6,13,15H2,1-5H3,(H,26,28) |
| InChIKey | DYGXSOQXJCYTRI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|