C22H26BFN2O4 — CID 170812314
benzyl N-[3-(6-fluoro-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170812314) has the molecular formula C22H26BFN2O4 and a molecular weight of 412.27 g/mol. Its IUPAC name is benzyl N-[3-(6-fluoro-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(6-fluoro-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170812314 |
| Molecular Formula | C22H26BFN2O4 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | benzyl N-[3-(6-fluoro-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2ccc(F)nc2)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C22H26BFN2O4/c1-21(2)22(3,4)30-23(29-21)18(12-17-10-11-19(24)25-13-17)14-26-20(27)28-15-16-8-6-5-7-9-16/h5-13H,14-15H2,1-4H3,(H,26,27) |
| InChIKey | MVTHIDQLTWEMCJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|