C23H29BFN3O4 — CID 170812805
benzyl N-[3-(3-fluoro-4-hydrazinylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170812805) has the molecular formula C23H29BFN3O4 and a molecular weight of 441.31 g/mol. Its IUPAC name is benzyl N-[3-(3-fluoro-4-hydrazinylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(3-fluoro-4-hydrazinylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170812805 |
| Molecular Formula | C23H29BFN3O4 |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | benzyl N-[3-(3-fluoro-4-hydrazinylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2ccc(NN)c(F)c2)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C23H29BFN3O4/c1-22(2)23(3,4)32-24(31-22)18(12-17-10-11-20(28-26)19(25)13-17)14-27-21(29)30-15-16-8-6-5-7-9-16/h5-13,28H,14-15,26H2,1-4H3,(H,27,29) |
| InChIKey | UVMXXYROYNBNMI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|