C29H32BNO4 — CID 170813528
benzyl N-[3-(3-phenylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170813528) has the molecular formula C29H32BNO4 and a molecular weight of 469.39 g/mol. Its IUPAC name is benzyl N-[3-(3-phenylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(3-phenylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170813528 |
| Molecular Formula | C29H32BNO4 |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | benzyl N-[3-(3-phenylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2cccc(-c3ccccc3)c2)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C29H32BNO4/c1-28(2)29(3,4)35-30(34-28)26(20-31-27(32)33-21-22-12-7-5-8-13-22)19-23-14-11-17-25(18-23)24-15-9-6-10-16-24/h5-19H,20-21H2,1-4H3,(H,31,32) |
| InChIKey | VGWIRFRXWBOTSI-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|