C25H28BNO5 — CID 170812982
benzyl N-[3-(1-benzofuran-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170812982) has the molecular formula C25H28BNO5 and a molecular weight of 433.31 g/mol. Its IUPAC name is benzyl N-[3-(1-benzofuran-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(1-benzofuran-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170812982 |
| Molecular Formula | C25H28BNO5 |
| Molecular Weight | 433.31 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | benzyl N-[3-(1-benzofuran-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2ccc3occc3c2)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C25H28BNO5/c1-24(2)25(3,4)32-26(31-24)21(15-19-10-11-22-20(14-19)12-13-29-22)16-27-23(28)30-17-18-8-6-5-7-9-18/h5-15H,16-17H2,1-4H3,(H,27,28) |
| InChIKey | SEGZVMYEODRDOK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.31 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|