C26H29BN2O6 — CID 170813556
5-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2-carboxylic acid (PubChem CID 170813556) has the molecular formula C26H29BN2O6 and a molecular weight of 476.34 g/mol. Its IUPAC name is 5-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2-carboxylic acid.
| Compound Name | 5-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 170813556 |
| Molecular Formula | C26H29BN2O6 |
| Molecular Weight | 476.34 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 5-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2-carboxylic acid |
| SMILES | CC1(C)OB(C(=Cc2ccc3[nH]c(C(=O)O)cc3c2)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C26H29BN2O6/c1-25(2)26(3,4)35-27(34-25)20(15-28-24(32)33-16-17-8-6-5-7-9-17)13-18-10-11-21-19(12-18)14-22(29-21)23(30)31/h5-14,29H,15-16H2,1-4H3,(H,28,32)(H,30,31) |
| InChIKey | IJDUSMJBBOWNFD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|