C29H39B2NO6 — CID 170813729
benzyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enyl]carbamate (PubChem CID 170813729) has the molecular formula C29H39B2NO6 and a molecular weight of 519.26 g/mol. Its IUPAC name is benzyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enyl]carbamate.
| Compound Name | benzyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170813729 |
| Molecular Formula | C29H39B2NO6 |
| Molecular Weight | 519.26 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | benzyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2cccc(B3OC(C)(C)C(C)(C)O3)c2)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C29H39B2NO6/c1-26(2)27(3,4)36-30(35-26)23-16-12-15-22(17-23)18-24(31-37-28(5,6)29(7,8)38-31)19-32-25(33)34-20-21-13-10-9-11-14-21/h9-18H,19-20H2,1-8H3,(H,32,33) |
| InChIKey | CCTXGAWZQQTUTG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.26 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|