C25H32BNO5 — CID 170812777
benzyl N-[3-(3-ethoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170812777) has the molecular formula C25H32BNO5 and a molecular weight of 437.35 g/mol. Its IUPAC name is benzyl N-[3-(3-ethoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(3-ethoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170812777 |
| Molecular Formula | C25H32BNO5 |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | benzyl N-[3-(3-ethoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CCOc1cccc(C=C(CNC(=O)OCc2ccccc2)B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C25H32BNO5/c1-6-29-22-14-10-13-20(16-22)15-21(26-31-24(2,3)25(4,5)32-26)17-27-23(28)30-18-19-11-8-7-9-12-19/h7-16H,6,17-18H2,1-5H3,(H,27,28) |
| InChIKey | AQNCPHQHPSWHAH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|