C26H34BNO6 — CID 170813355
benzyl N-[3-[4-(2-methoxyethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170813355) has the molecular formula C26H34BNO6 and a molecular weight of 467.37 g/mol. Its IUPAC name is benzyl N-[3-[4-(2-methoxyethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-[4-(2-methoxyethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170813355 |
| Molecular Formula | C26H34BNO6 |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | benzyl N-[3-[4-(2-methoxyethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | COCCOc1ccc(C=C(CNC(=O)OCc2ccccc2)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C26H34BNO6/c1-25(2)26(3,4)34-27(33-25)22(17-20-11-13-23(14-12-20)31-16-15-30-5)18-28-24(29)32-19-21-9-7-6-8-10-21/h6-14,17H,15-16,18-19H2,1-5H3,(H,28,29) |
| InChIKey | NODBQCFGCAZNOY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|