C27H32BNO6 — CID 170813583
methyl (E)-3-[4-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]prop-2-enoate (PubChem CID 170813583) has the molecular formula C27H32BNO6 and a molecular weight of 477.37 g/mol. Its IUPAC name is methyl (E)-3-[4-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 170813583 |
| Molecular Formula | C27H32BNO6 |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | methyl (E)-3-[4-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(C=C(CNC(=O)OCc2ccccc2)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C27H32BNO6/c1-26(2)27(3,4)35-28(34-26)23(18-29-25(31)33-19-22-9-7-6-8-10-22)17-21-13-11-20(12-14-21)15-16-24(30)32-5/h6-17H,18-19H2,1-5H3,(H,29,31)/b16-15+,23-17? |
| InChIKey | KNZNEHNNMPCMHH-QHTJENDRSA-N |
| XLogP | 4.81 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|