C28H38BN3O4 — CID 170813675
benzyl N-[3-[4-(4-methylpiperazin-1-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170813675) has the molecular formula C28H38BN3O4 and a molecular weight of 491.44 g/mol. Its IUPAC name is benzyl N-[3-[4-(4-methylpiperazin-1-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-[4-(4-methylpiperazin-1-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170813675 |
| Molecular Formula | C28H38BN3O4 |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | benzyl N-[3-[4-(4-methylpiperazin-1-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CN1CCN(c2ccc(C=C(CNC(=O)OCc3ccccc3)B3OC(C)(C)C(C)(C)O3)cc2)CC1 |
| InChI | InChI=1S/C28H38BN3O4/c1-27(2)28(3,4)36-29(35-27)24(20-30-26(33)34-21-23-9-7-6-8-10-23)19-22-11-13-25(14-12-22)32-17-15-31(5)16-18-32/h6-14,19H,15-18,20-21H2,1-5H3,(H,30,33) |
| InChIKey | XGQZLAWXDBJDLH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|