C22H26BNO7 — CID 170812478
5-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]furan-2-carboxylic acid (PubChem CID 170812478) has the molecular formula C22H26BNO7 and a molecular weight of 427.26 g/mol. Its IUPAC name is 5-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]furan-2-carboxylic acid.
| Compound Name | 5-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 170812478 |
| Molecular Formula | C22H26BNO7 |
| Molecular Weight | 427.26 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 5-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]furan-2-carboxylic acid |
| SMILES | CC1(C)OB(C(=Cc2ccc(C(=O)O)o2)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C22H26BNO7/c1-21(2)22(3,4)31-23(30-21)16(12-17-10-11-18(29-17)19(25)26)13-24-20(27)28-14-15-8-6-5-7-9-15/h5-12H,13-14H2,1-4H3,(H,24,27)(H,25,26) |
| InChIKey | PWLLSNMUAXRSGY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.26 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|