C24H31BN2O4 — CID 170812574
benzyl N-[3-(4-amino-2-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170812574) has the molecular formula C24H31BN2O4 and a molecular weight of 422.33 g/mol. Its IUPAC name is benzyl N-[3-(4-amino-2-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(4-amino-2-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170812574 |
| Molecular Formula | C24H31BN2O4 |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | benzyl N-[3-(4-amino-2-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | Cc1cc(N)ccc1C=C(CNC(=O)OCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C24H31BN2O4/c1-17-13-21(26)12-11-19(17)14-20(25-30-23(2,3)24(4,5)31-25)15-27-22(28)29-16-18-9-7-6-8-10-18/h6-14H,15-16,26H2,1-5H3,(H,27,28) |
| InChIKey | PSPISHPGBZMBRV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|