C20H27BN4O4 — CID 170812260
benzyl N-[3-(5-amino-1H-pyrazol-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170812260) has the molecular formula C20H27BN4O4 and a molecular weight of 398.27 g/mol. Its IUPAC name is benzyl N-[3-(5-amino-1H-pyrazol-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(5-amino-1H-pyrazol-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170812260 |
| Molecular Formula | C20H27BN4O4 |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | benzyl N-[3-(5-amino-1H-pyrazol-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2cn[nH]c2N)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C20H27BN4O4/c1-19(2)20(3,4)29-21(28-19)16(10-15-11-24-25-17(15)22)12-23-18(26)27-13-14-8-6-5-7-9-14/h5-11H,12-13H2,1-4H3,(H,23,26)(H3,22,24,25) |
| InChIKey | LQOINSPENDJARH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|